C21H32F2N10O2 — CID 165401929
N-[2-[[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-[5-(methylamino)pentyl]amino]ethyl]formamide (PubChem CID 165401929) has the molecular formula C21H32F2N10O2 and a molecular weight of 494.55 g/mol. Its IUPAC name is N-[2-[[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-[5-(methylamino)pentyl]amino]ethyl]formamide.
| Compound Name | N-[2-[[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-[5-(methylamino)pentyl]amino]ethyl]formamide |
|---|---|
| PubChem CID | 165401929 |
| Molecular Formula | C21H32F2N10O2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | N-[2-[[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-[5-(methylamino)pentyl]amino]ethyl]formamide |
| SMILES | CNCCCCCN(CCNC=O)c1nc(-c2cnc(N)nc2C(F)F)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H32F2N10O2/c1-25-5-3-2-4-7-32(8-6-26-14-34)20-29-18(15-13-27-19(24)28-16(15)17(22)23)30-21(31-20)33-9-11-35-12-10-33/h13-14,17,25H,2-12H2,1H3,(H,26,34)(H2,24,27,28) |
| InChIKey | CVWFGXYJNPZDJJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|