C28H40F2N10O3 — CID 165401978
N-[3-[4-[4-[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]-4-oxobutyl]hept-6-enyl]formamide (PubChem CID 165401978) has the molecular formula C28H40F2N10O3 and a molecular weight of 602.69 g/mol. Its IUPAC name is N-[3-[4-[4-[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]-4-oxobutyl]hept-6-enyl]formamide.
| Compound Name | N-[3-[4-[4-[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]-4-oxobutyl]hept-6-enyl]formamide |
|---|---|
| PubChem CID | 165401978 |
| Molecular Formula | C28H40F2N10O3 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | N-[3-[4-[4-[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]-4-oxobutyl]hept-6-enyl]formamide |
| SMILES | C=CCCC(CCCC(=O)N1CCN(c2nc(-c3cnc(N)nc3C(F)F)nc(N3CCOCC3)n2)CC1)CCNC=O |
| InChI | InChI=1S/C28H40F2N10O3/c1-2-3-5-20(8-9-32-19-41)6-4-7-22(42)38-10-12-39(13-11-38)27-35-25(21-18-33-26(31)34-23(21)24(29)30)36-28(37-27)40-14-16-43-17-15-40/h2,18-20,24H,1,3-17H2,(H,32,41)(H2,31,33,34) |
| InChIKey | GFZLRFNRXNENEV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 155.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|