C23H31F2N9O3 — CID 165402007
N-[2-[[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-[(E)-5-oxooct-6-enyl]amino]ethyl]formamide (PubChem CID 165402007) has the molecular formula C23H31F2N9O3 and a molecular weight of 519.56 g/mol. Its IUPAC name is N-[2-[[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-[(E)-5-oxooct-6-enyl]amino]ethyl]formamide.
| Compound Name | N-[2-[[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-[(E)-5-oxooct-6-enyl]amino]ethyl]formamide |
|---|---|
| PubChem CID | 165402007 |
| Molecular Formula | C23H31F2N9O3 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | N-[2-[[4-[2-amino-4-(difluoromethyl)pyrimidin-5-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-[(E)-5-oxooct-6-enyl]amino]ethyl]formamide |
| SMILES | C/C=C/C(=O)CCCCN(CCNC=O)c1nc(-c2cnc(N)nc2C(F)F)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C23H31F2N9O3/c1-2-5-16(36)6-3-4-8-33(9-7-27-15-35)22-30-20(17-14-28-21(26)29-18(17)19(24)25)31-23(32-22)34-10-12-37-13-11-34/h2,5,14-15,19H,3-4,6-13H2,1H3,(H,27,35)(H2,26,28,29)/b5-2+ |
| InChIKey | SEFKCIPLMIVIFK-GORDUTHDSA-N |
| XLogP | 1.55 |
| TPSA | 152.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|