C24H24N4O5 — CID 165403461
2-(2,6-dioxopiperidin-3-yl)-5-[4-[[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methyl]-2-pyridinyl]isoindole-1,3-dione (PubChem CID 165403461) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methyl]-2-pyridinyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methyl]-2-pyridinyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 165403461 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methyl]-2-pyridinyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(-c4cc(CN5CC[C@H](CO)C5)ccn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H24N4O5/c29-13-15-6-8-27(12-15)11-14-5-7-25-19(9-14)16-1-2-17-18(10-16)24(33)28(23(17)32)20-3-4-21(30)26-22(20)31/h1-2,5,7,9-10,15,20,29H,3-4,6,8,11-13H2,(H,26,30,31)/t15-,20?/m0/s1 |
| InChIKey | SEXCDGLCWHPGHR-OOJLDXBWSA-N |
| XLogP | 0.96 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|