C24H28F4N3O2SSi — CID 165405211
CID 165405211 (PubChem CID 165405211) has the molecular formula C24H28F4N3O2SSi and a molecular weight of 526.65 g/mol.
| Compound Name | CID 165405211 |
|---|---|
| PubChem CID | 165405211 |
| Molecular Formula | C24H28F4N3O2SSi |
| Molecular Weight | 526.65 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | — |
| SMILES | CN(C)[C@H](CNC(=O)C[C@H](c1ccsc1)C1(C(F)(F)F)CC1)[C@H]([Si])Cc1ccc(C(N)=O)c(F)c1 |
| InChI | InChI=1S/C24H28F4N3O2SSi/c1-31(2)19(20(35)10-14-3-4-16(22(29)33)18(25)9-14)12-30-21(32)11-17(15-5-8-34-13-15)23(6-7-23)24(26,27)28/h3-5,8-9,13,17,19-20H,6-7,10-12H2,1-2H3,(H2,29,33)(H,30,32)/t17-,19-,20-/m1/s1 |
| InChIKey | RWDYLRQDZWWVBK-MISYRCLQSA-N |
| XLogP | 4.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|