C25H31N3O3 — CID 165405809
2-[[(1R)-1-[2-[bis[(4-methoxyphenyl)methyl]amino]-3-pyridinyl]ethyl]amino]ethanol (PubChem CID 165405809) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[[(1R)-1-[2-[bis[(4-methoxyphenyl)methyl]amino]-3-pyridinyl]ethyl]amino]ethanol.
| Compound Name | 2-[[(1R)-1-[2-[bis[(4-methoxyphenyl)methyl]amino]-3-pyridinyl]ethyl]amino]ethanol |
|---|---|
| PubChem CID | 165405809 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 2-[[(1R)-1-[2-[bis[(4-methoxyphenyl)methyl]amino]-3-pyridinyl]ethyl]amino]ethanol |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2ncccc2[C@@H](C)NCCO)cc1 |
| InChI | InChI=1S/C25H31N3O3/c1-19(26-15-16-29)24-5-4-14-27-25(24)28(17-20-6-10-22(30-2)11-7-20)18-21-8-12-23(31-3)13-9-21/h4-14,19,26,29H,15-18H2,1-3H3/t19-/m1/s1 |
| InChIKey | VBJRFVUDHOXNGX-LJQANCHMSA-N |
| XLogP | 3.95 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |