C16H22N4O2 — CID 174189613
2-[1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]ethylamino]ethanol (PubChem CID 174189613) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-[1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]ethylamino]ethanol.
| Compound Name | 2-[1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]ethylamino]ethanol |
|---|---|
| PubChem CID | 174189613 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-[1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]ethylamino]ethanol |
| SMILES | COc1ccc(CNc2nccnc2C(C)NCCO)cc1 |
| InChI | InChI=1S/C16H22N4O2/c1-12(17-9-10-21)15-16(19-8-7-18-15)20-11-13-3-5-14(22-2)6-4-13/h3-8,12,17,21H,9-11H2,1-2H3,(H,19,20) |
| InChIKey | ILJKPKIHKZLWIF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |