C17H19N3O3 — CID 176616355
1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]pentane-1,3-dione (PubChem CID 176616355) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]pentane-1,3-dione.
| Compound Name | 1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]pentane-1,3-dione |
|---|---|
| PubChem CID | 176616355 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]pentane-1,3-dione |
| SMILES | CCC(=O)CC(=O)c1nccnc1NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H19N3O3/c1-3-13(21)10-15(22)16-17(19-9-8-18-16)20-11-12-4-6-14(23-2)7-5-12/h4-9H,3,10-11H2,1-2H3,(H,19,20) |
| InChIKey | JQMCHXZTOYVFPC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|