C26H35N5O5 — CID 176616321
tert-butyl 4-[1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]-1,3-dioxopentan-2-yl]piperazine-1-carboxylate (PubChem CID 176616321) has the molecular formula C26H35N5O5 and a molecular weight of 497.60 g/mol. Its IUPAC name is tert-butyl 4-[1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]-1,3-dioxopentan-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]-1,3-dioxopentan-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176616321 |
| Molecular Formula | C26H35N5O5 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | tert-butyl 4-[1-[3-[(4-methoxyphenyl)methylamino]pyrazin-2-yl]-1,3-dioxopentan-2-yl]piperazine-1-carboxylate |
| SMILES | CCC(=O)C(C(=O)c1nccnc1NCc1ccc(OC)cc1)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C26H35N5O5/c1-6-20(32)22(30-13-15-31(16-14-30)25(34)36-26(2,3)4)23(33)21-24(28-12-11-27-21)29-17-18-7-9-19(35-5)10-8-18/h7-12,22H,6,13-17H2,1-5H3,(H,28,29) |
| InChIKey | PMLBDOTVDSXLSQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|