C13H13BrN4O2 — CID 89346524
5-bromo-3-[(4-methoxyphenyl)methylamino]pyrazine-2-carboxamide (PubChem CID 89346524) has the molecular formula C13H13BrN4O2 and a molecular weight of 337.18 g/mol. Its IUPAC name is 5-bromo-3-[(4-methoxyphenyl)methylamino]pyrazine-2-carboxamide.
| Compound Name | 5-bromo-3-[(4-methoxyphenyl)methylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 89346524 |
| Molecular Formula | C13H13BrN4O2 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 5-bromo-3-[(4-methoxyphenyl)methylamino]pyrazine-2-carboxamide |
| SMILES | COc1ccc(CNc2nc(Br)cnc2C(N)=O)cc1 |
| InChI | InChI=1S/C13H13BrN4O2/c1-20-9-4-2-8(3-5-9)6-17-13-11(12(15)19)16-7-10(14)18-13/h2-5,7H,6H2,1H3,(H2,15,19)(H,17,18) |
| InChIKey | JHFGDVAXGVDKLJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |