C18H22BrN3O3Si — CID 165406438
5-bromo-2-[6-(2-trimethylsilylethoxymethoxy)pyridazin-3-yl]-3H-isoindol-1-one (PubChem CID 165406438) has the molecular formula C18H22BrN3O3Si and a molecular weight of 436.38 g/mol. Its IUPAC name is 5-bromo-2-[6-(2-trimethylsilylethoxymethoxy)pyridazin-3-yl]-3H-isoindol-1-one.
| Compound Name | 5-bromo-2-[6-(2-trimethylsilylethoxymethoxy)pyridazin-3-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 165406438 |
| Molecular Formula | C18H22BrN3O3Si |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 5-bromo-2-[6-(2-trimethylsilylethoxymethoxy)pyridazin-3-yl]-3H-isoindol-1-one |
| SMILES | C[Si](C)(C)CCOCOc1ccc(N2Cc3cc(Br)ccc3C2=O)nn1 |
| InChI | InChI=1S/C18H22BrN3O3Si/c1-26(2,3)9-8-24-12-25-17-7-6-16(20-21-17)22-11-13-10-14(19)4-5-15(13)18(22)23/h4-7,10H,8-9,11-12H2,1-3H3 |
| InChIKey | RNZDLUXEPCYDLC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|