C18H23N3O4Si — CID 165406423
5-hydroxy-2-[6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-3-yl]-3H-isoindol-1-one (PubChem CID 165406423) has the molecular formula C18H23N3O4Si and a molecular weight of 373.49 g/mol. Its IUPAC name is 5-hydroxy-2-[6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-3-yl]-3H-isoindol-1-one.
| Compound Name | 5-hydroxy-2-[6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-3-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 165406423 |
| Molecular Formula | C18H23N3O4Si |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 5-hydroxy-2-[6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-3-yl]-3H-isoindol-1-one |
| SMILES | C[Si](C)(C)CCOCn1nc(N2Cc3cc(O)ccc3C2=O)ccc1=O |
| InChI | InChI=1S/C18H23N3O4Si/c1-26(2,3)9-8-25-12-21-17(23)7-6-16(19-21)20-11-13-10-14(22)4-5-15(13)18(20)24/h4-7,10,22H,8-9,11-12H2,1-3H3 |
| InChIKey | YONPJTKTLUVUQH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|