C11H14N2OS — CID 165408000
(1Z,3E,4E)-3-(methoxymethylimino)-5-thiophen-2-ylpenta-1,4-dien-1-amine (PubChem CID 165408000) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is (1Z,3E,4E)-3-(methoxymethylimino)-5-thiophen-2-ylpenta-1,4-dien-1-amine.
| Compound Name | (1Z,3E,4E)-3-(methoxymethylimino)-5-thiophen-2-ylpenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 165408000 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (1Z,3E,4E)-3-(methoxymethylimino)-5-thiophen-2-ylpenta-1,4-dien-1-amine |
| SMILES | COC/N=C(/C=C\N)\C=C\c1cccs1 |
| InChI | InChI=1S/C11H14N2OS/c1-14-9-13-10(6-7-12)4-5-11-3-2-8-15-11/h2-8H,9,12H2,1H3/b5-4+,7-6-,13-10+ |
| InChIKey | WEXZSIKYBWFSIR-PHDOKWNMSA-N |
| XLogP | 2.28 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|