C18H25ClN2 — CID 165410059
2-[2-(5-chloro-2-methylphenyl)ethyl]-3-methylpyridine;N-methylethanamine (PubChem CID 165410059) has the molecular formula C18H25ClN2 and a molecular weight of 304.87 g/mol. Its IUPAC name is 2-[2-(5-chloro-2-methylphenyl)ethyl]-3-methylpyridine;N-methylethanamine.
| Compound Name | 2-[2-(5-chloro-2-methylphenyl)ethyl]-3-methylpyridine;N-methylethanamine |
|---|---|
| PubChem CID | 165410059 |
| Molecular Formula | C18H25ClN2 |
| Molecular Weight | 304.87 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-[2-(5-chloro-2-methylphenyl)ethyl]-3-methylpyridine;N-methylethanamine |
| SMILES | CCNC.Cc1ccc(Cl)cc1CCc1ncccc1C |
| InChI | InChI=1S/C15H16ClN.C3H9N/c1-11-5-7-14(16)10-13(11)6-8-15-12(2)4-3-9-17-15;1-3-4-2/h3-5,7,9-10H,6,8H2,1-2H3;4H,3H2,1-2H3 |
| InChIKey | JCVISCFVQRWJJL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |