C19H25FN2 — CID 165410379
3-(2-fluoro-6-propylphenyl)-N-methyl-2-(3-methyl-2-pyridinyl)propan-1-amine (PubChem CID 165410379) has the molecular formula C19H25FN2 and a molecular weight of 300.42 g/mol. Its IUPAC name is 3-(2-fluoro-6-propylphenyl)-N-methyl-2-(3-methyl-2-pyridinyl)propan-1-amine.
| Compound Name | 3-(2-fluoro-6-propylphenyl)-N-methyl-2-(3-methyl-2-pyridinyl)propan-1-amine |
|---|---|
| PubChem CID | 165410379 |
| Molecular Formula | C19H25FN2 |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 3-(2-fluoro-6-propylphenyl)-N-methyl-2-(3-methyl-2-pyridinyl)propan-1-amine |
| SMILES | CCCc1cccc(F)c1CC(CNC)c1ncccc1C |
| InChI | InChI=1S/C19H25FN2/c1-4-7-15-9-5-10-18(20)17(15)12-16(13-21-3)19-14(2)8-6-11-22-19/h5-6,8-11,16,21H,4,7,12-13H2,1-3H3 |
| InChIKey | XWWAWUZMIFRYJH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |