C16H17ClI2N2 — CID 165410548
2-(4-chloro-2-iodophenyl)-3-[3-(iodomethyl)-2-pyridinyl]-N-methylpropan-1-amine (PubChem CID 165410548) has the molecular formula C16H17ClI2N2 and a molecular weight of 526.59 g/mol. Its IUPAC name is 2-(4-chloro-2-iodophenyl)-3-[3-(iodomethyl)-2-pyridinyl]-N-methylpropan-1-amine.
| Compound Name | 2-(4-chloro-2-iodophenyl)-3-[3-(iodomethyl)-2-pyridinyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 165410548 |
| Molecular Formula | C16H17ClI2N2 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 525.92 |
| IUPAC Name | 2-(4-chloro-2-iodophenyl)-3-[3-(iodomethyl)-2-pyridinyl]-N-methylpropan-1-amine |
| SMILES | CNCC(Cc1ncccc1CI)c1ccc(Cl)cc1I |
| InChI | InChI=1S/C16H17ClI2N2/c1-20-10-12(14-5-4-13(17)8-15(14)19)7-16-11(9-18)3-2-6-21-16/h2-6,8,12,20H,7,9-10H2,1H3 |
| InChIKey | PFNLWOQZZJRBKX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|