C23H26N4O2S — CID 16541085
2-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide (PubChem CID 16541085) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide.
| Compound Name | 2-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide |
|---|---|
| PubChem CID | 16541085 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide |
| SMILES | COc1ccccc1-c1nnc(SC(C)C(=O)NC2CCCc3ccccc32)n1C |
| InChI | InChI=1S/C23H26N4O2S/c1-15(22(28)24-19-13-8-10-16-9-4-5-11-17(16)19)30-23-26-25-21(27(23)2)18-12-6-7-14-20(18)29-3/h4-7,9,11-12,14-15,19H,8,10,13H2,1-3H3,(H,24,28) |
| InChIKey | QHNGACOMWRQNAF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |