C22H24N4OS — CID 7257729
(2R)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide (PubChem CID 7257729) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is (2R)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide.
| Compound Name | (2R)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide |
|---|---|
| PubChem CID | 7257729 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (2R)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide |
| SMILES | Cc1ccccc1-n1cnnc1S[C@H](C)C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C22H24N4OS/c1-15-8-3-6-13-20(15)26-14-23-25-22(26)28-16(2)21(27)24-19-12-7-10-17-9-4-5-11-18(17)19/h3-6,8-9,11,13-14,16,19H,7,10,12H2,1-2H3,(H,24,27)/t16-,19-/m1/s1 |
| InChIKey | MQPYMPAQBJBLEH-VQIMIIECSA-N |
| XLogP | 4.25 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |