About silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide
silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide (PubChem CID 165411671) has the molecular formula C13H10AgBrN2O3S
and a molecular weight of 462.07 g/mol. Its IUPAC name is silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide.
Molecular Properties
| Compound Name | silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide |
| PubChem CID | 165411671 |
| Molecular Formula | C13H10AgBrN2O3S |
| Molecular Weight | 462.07 g/mol |
| Exact Mass | 459.86 |
| IUPAC Name | silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide |
| SMILES | NC(=O)c1ccc(Br)cc1-c1cccc([N+](=O)[O-])c1.[Ag+].[SH-] |
| InChI | InChI=1S/C13H9BrN2O3.Ag.H2S/c14-9-4-5-11(13(15)17)12(7-9)8-2-1-3-10(6-8)16(18)19;;/h1-7H,(H2,15,17);;1H2/q;+1;/p-1 |
| InChIKey | FBUFNWMOIYAIOA-UHFFFAOYSA-M |
| XLogP | 2.85 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.07 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide?
The IUPAC name of silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide (CID 165411671) is silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide.
What is the SMILES notation for silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide?
The canonical SMILES for silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide is NC(=O)c1ccc(Br)cc1-c1cccc([N+](=O)[O-])c1.[Ag+].[SH-].
What is the InChIKey of silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide?
The InChIKey is FBUFNWMOIYAIOA-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H9BrN2O3.Ag.H2S/c14-9-4-5-11(13(15)17)12(7-9)8-2-1-3-10(6-8)16(18)19;;/h1-7H,(H2,15,17);;1H2/q;+1;/p-1.
What are the key properties of silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide?
silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide has a molecular weight of 462.07 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silver;4-bromo-2-(3-nitrophenyl)benzamide;sulfanide is sourced from PubChem (CID 165411671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).