C23H39BO3 — CID 165413285
2-[(3R,5S,6R)-7-(4-methoxyphenyl)-3,5,6-trimethylheptyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 165413285) has the molecular formula C23H39BO3 and a molecular weight of 374.37 g/mol. Its IUPAC name is 2-[(3R,5S,6R)-7-(4-methoxyphenyl)-3,5,6-trimethylheptyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(3R,5S,6R)-7-(4-methoxyphenyl)-3,5,6-trimethylheptyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 165413285 |
| Molecular Formula | C23H39BO3 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | 2-[(3R,5S,6R)-7-(4-methoxyphenyl)-3,5,6-trimethylheptyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COc1ccc(C[C@@H](C)[C@@H](C)C[C@H](C)CCB2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C23H39BO3/c1-17(13-14-24-26-22(4,5)23(6,7)27-24)15-18(2)19(3)16-20-9-11-21(25-8)12-10-20/h9-12,17-19H,13-16H2,1-8H3/t17-,18+,19-/m1/s1 |
| InChIKey | AODUJLBZCNBBIM-CEXWTWQISA-N |
| XLogP | 6.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|