C24H24O2S — CID 165413342
[(E,3R)-5-(3,5-dimethylphenyl)-1-thiophen-3-ylpent-1-en-3-yl] benzoate (PubChem CID 165413342) has the molecular formula C24H24O2S and a molecular weight of 376.52 g/mol. Its IUPAC name is [(E,3R)-5-(3,5-dimethylphenyl)-1-thiophen-3-ylpent-1-en-3-yl] benzoate.
| Compound Name | [(E,3R)-5-(3,5-dimethylphenyl)-1-thiophen-3-ylpent-1-en-3-yl] benzoate |
|---|---|
| PubChem CID | 165413342 |
| Molecular Formula | C24H24O2S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [(E,3R)-5-(3,5-dimethylphenyl)-1-thiophen-3-ylpent-1-en-3-yl] benzoate |
| SMILES | Cc1cc(C)cc(CC[C@H](/C=C/c2ccsc2)OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H24O2S/c1-18-14-19(2)16-21(15-18)9-11-23(10-8-20-12-13-27-17-20)26-24(25)22-6-4-3-5-7-22/h3-8,10,12-17,23H,9,11H2,1-2H3/b10-8+/t23-/m0/s1 |
| InChIKey | MJJUONIZELDCGS-LBQODKDLSA-N |
| XLogP | 6.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |