C21H24N2O4S — CID 165413763
[(2S)-4-methylsulfonylbutan-2-yl] (2S)-2-amino-2-[2-(1H-indol-3-yl)phenyl]acetate (PubChem CID 165413763) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is [(2S)-4-methylsulfonylbutan-2-yl] (2S)-2-amino-2-[2-(1H-indol-3-yl)phenyl]acetate.
| Compound Name | [(2S)-4-methylsulfonylbutan-2-yl] (2S)-2-amino-2-[2-(1H-indol-3-yl)phenyl]acetate |
|---|---|
| PubChem CID | 165413763 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | [(2S)-4-methylsulfonylbutan-2-yl] (2S)-2-amino-2-[2-(1H-indol-3-yl)phenyl]acetate |
| SMILES | C[C@@H](CCS(C)(=O)=O)OC(=O)[C@@H](N)c1ccccc1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H24N2O4S/c1-14(11-12-28(2,25)26)27-21(24)20(22)17-9-4-3-7-15(17)18-13-23-19-10-6-5-8-16(18)19/h3-10,13-14,20,23H,11-12,22H2,1-2H3/t14-,20-/m0/s1 |
| InChIKey | WJMSCNJAZZDQNU-XOBRGWDASA-N |
| XLogP | 3.20 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |