C20H19ClF4N8O3S — CID 165413951
7-amino-6-chloro-2-ethyl-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide (PubChem CID 165413951) has the molecular formula C20H19ClF4N8O3S and a molecular weight of 562.94 g/mol. Its IUPAC name is 7-amino-6-chloro-2-ethyl-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 7-amino-6-chloro-2-ethyl-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 165413951 |
| Molecular Formula | C20H19ClF4N8O3S |
| Molecular Weight | 562.94 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | 7-amino-6-chloro-2-ethyl-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CCc1nc2nc(N)c(Cl)cn2c1C(=O)NCc1ccc(N2CCN(S(=O)(=O)C(F)(F)F)C=N2)c(F)c1 |
| InChI | InChI=1S/C20H19ClF4N8O3S/c1-2-14-16(32-9-12(21)17(26)30-19(32)29-14)18(34)27-8-11-3-4-15(13(22)7-11)33-6-5-31(10-28-33)37(35,36)20(23,24)25/h3-4,7,9-10H,2,5-6,8H2,1H3,(H,27,34)(H2,26,29,30) |
| InChIKey | SACIDMXPHROLSO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 138.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.94 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |