C23H22N8O2 — CID 165414911
6-cyclopropyl-N-[3-(5-phenyl-1,2,4-oxadiazol-3-yl)propyl]-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide (PubChem CID 165414911) has the molecular formula C23H22N8O2 and a molecular weight of 442.48 g/mol. Its IUPAC name is 6-cyclopropyl-N-[3-(5-phenyl-1,2,4-oxadiazol-3-yl)propyl]-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide.
| Compound Name | 6-cyclopropyl-N-[3-(5-phenyl-1,2,4-oxadiazol-3-yl)propyl]-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 165414911 |
| Molecular Formula | C23H22N8O2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 6-cyclopropyl-N-[3-(5-phenyl-1,2,4-oxadiazol-3-yl)propyl]-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide |
| SMILES | O=C(NCCCc1noc(-c2ccccc2)n1)c1nc(C2CC2)cnc1Nc1cncnc1 |
| InChI | InChI=1S/C23H22N8O2/c32-22(26-10-4-7-19-30-23(33-31-19)16-5-2-1-3-6-16)20-21(28-17-11-24-14-25-12-17)27-13-18(29-20)15-8-9-15/h1-3,5-6,11-15H,4,7-10H2,(H,26,32)(H,27,28) |
| InChIKey | PUABEWVZPJCUIZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|