C21H18N8O — CID 165415174
6-cyclopropyl-3-(pyrimidin-5-ylamino)-N-(quinoxalin-6-ylmethyl)pyrazine-2-carboxamide (PubChem CID 165415174) has the molecular formula C21H18N8O and a molecular weight of 398.43 g/mol. Its IUPAC name is 6-cyclopropyl-3-(pyrimidin-5-ylamino)-N-(quinoxalin-6-ylmethyl)pyrazine-2-carboxamide.
| Compound Name | 6-cyclopropyl-3-(pyrimidin-5-ylamino)-N-(quinoxalin-6-ylmethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 165415174 |
| Molecular Formula | C21H18N8O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 6-cyclopropyl-3-(pyrimidin-5-ylamino)-N-(quinoxalin-6-ylmethyl)pyrazine-2-carboxamide |
| SMILES | O=C(NCc1ccc2nccnc2c1)c1nc(C2CC2)cnc1Nc1cncnc1 |
| InChI | InChI=1S/C21H18N8O/c30-21(27-8-13-1-4-16-17(7-13)25-6-5-24-16)19-20(28-15-9-22-12-23-10-15)26-11-18(29-19)14-2-3-14/h1,4-7,9-12,14H,2-3,8H2,(H,26,28)(H,27,30) |
| InChIKey | WRSYZQKXBAXHAL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |