C24H27N7O — CID 165415240
N-(1-benzylpiperidin-4-yl)-6-cyclopropyl-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide (PubChem CID 165415240) has the molecular formula C24H27N7O and a molecular weight of 429.53 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-6-cyclopropyl-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-6-cyclopropyl-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 165415240 |
| Molecular Formula | C24H27N7O |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-6-cyclopropyl-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1nc(C2CC2)cnc1Nc1cncnc1 |
| InChI | InChI=1S/C24H27N7O/c32-24(29-19-8-10-31(11-9-19)15-17-4-2-1-3-5-17)22-23(28-20-12-25-16-26-13-20)27-14-21(30-22)18-6-7-18/h1-5,12-14,16,18-19H,6-11,15H2,(H,27,28)(H,29,32) |
| InChIKey | PQDUSYJXPWKFOK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |