C27H46O — CID 165416361
(1S,2R,5R,7R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.01,3.02,7.011,15]heptadecan-5-ol (PubChem CID 165416361) has the molecular formula C27H46O and a molecular weight of 386.66 g/mol. Its IUPAC name is (1S,2R,5R,7R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.01,3.02,7.011,15]heptadecan-5-ol.
| Compound Name | (1S,2R,5R,7R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.01,3.02,7.011,15]heptadecan-5-ol |
|---|---|
| PubChem CID | 165416361 |
| Molecular Formula | C27H46O |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.35 |
| IUPAC Name | (1S,2R,5R,7R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.01,3.02,7.011,15]heptadecan-5-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](O)CC5[C@]4(C)[C@]53CC[C@]12C |
| InChI | InChI=1S/C27H46O/c1-17(2)7-6-8-18(3)21-11-12-22-23-10-9-19-15-20(28)16-24-26(19,5)27(23,24)14-13-25(21,22)4/h17-24,28H,6-16H2,1-5H3/t18-,19-,20-,21-,22+,23+,24?,25-,26-,27+/m1/s1 |
| InChIKey | TYOCXPGTLLTRAM-DVWACBDHSA-N |
| XLogP | 7.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |