C27H47ClO — CID 57319926
(8S,9R,10S,13R,14S,17R)-9-chloro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 57319926) has the molecular formula C27H47ClO and a molecular weight of 423.13 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S,17R)-9-chloro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9R,10S,13R,14S,17R)-9-chloro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 57319926 |
| Molecular Formula | C27H47ClO |
| Molecular Weight | 423.13 g/mol |
| Exact Mass | 422.33 |
| IUPAC Name | (8S,9R,10S,13R,14S,17R)-9-chloro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CC(O)CC[C@]4(C)[C@@]3(Cl)CC[C@]12C |
| InChI | InChI=1S/C27H47ClO/c1-18(2)7-6-8-19(3)22-11-12-23-24-10-9-20-17-21(29)13-14-26(20,5)27(24,28)16-15-25(22,23)4/h18-24,29H,6-17H2,1-5H3/t19-,20?,21?,22-,23+,24+,25-,26+,27-/m1/s1 |
| InChIKey | AHDPTXUZNBOJOL-QPYNUDEISA-N |
| XLogP | 7.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.13 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|