C10H7BrF5NO3 — CID 165416862
methyl 5-bromo-2-oxo-1-(2,2,3,3,3-pentafluoropropyl)pyridine-3-carboxylate (PubChem CID 165416862) has the molecular formula C10H7BrF5NO3 and a molecular weight of 364.06 g/mol. Its IUPAC name is methyl 5-bromo-2-oxo-1-(2,2,3,3,3-pentafluoropropyl)pyridine-3-carboxylate.
| Compound Name | methyl 5-bromo-2-oxo-1-(2,2,3,3,3-pentafluoropropyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 165416862 |
| Molecular Formula | C10H7BrF5NO3 |
| Molecular Weight | 364.06 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | methyl 5-bromo-2-oxo-1-(2,2,3,3,3-pentafluoropropyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(Br)cn(CC(F)(F)C(F)(F)F)c1=O |
| InChI | InChI=1S/C10H7BrF5NO3/c1-20-8(19)6-2-5(11)3-17(7(6)18)4-9(12,13)10(14,15)16/h2-3H,4H2,1H3 |
| InChIKey | LIHXXMUJJSYUPH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.06 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|