C8H9BrN2O3 — CID 162514147
methyl 1-(2-amino-2-oxoethyl)-4-bromopyrrole-2-carboxylate (PubChem CID 162514147) has the molecular formula C8H9BrN2O3 and a molecular weight of 261.07 g/mol. Its IUPAC name is methyl 1-(2-amino-2-oxoethyl)-4-bromopyrrole-2-carboxylate.
| Compound Name | methyl 1-(2-amino-2-oxoethyl)-4-bromopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 162514147 |
| Molecular Formula | C8H9BrN2O3 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | methyl 1-(2-amino-2-oxoethyl)-4-bromopyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(Br)cn1CC(N)=O |
| InChI | InChI=1S/C8H9BrN2O3/c1-14-8(13)6-2-5(9)3-11(6)4-7(10)12/h2-3H,4H2,1H3,(H2,10,12) |
| InChIKey | UPHXETPUWAOEIC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |