C9H11ClN2O2 — CID 165471790
methyl 4-amino-1-(2-chloroprop-2-enyl)pyrrole-2-carboxylate (PubChem CID 165471790) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is methyl 4-amino-1-(2-chloroprop-2-enyl)pyrrole-2-carboxylate.
| Compound Name | methyl 4-amino-1-(2-chloroprop-2-enyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 165471790 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | methyl 4-amino-1-(2-chloroprop-2-enyl)pyrrole-2-carboxylate |
| SMILES | C=C(Cl)Cn1cc(N)cc1C(=O)OC |
| InChI | InChI=1S/C9H11ClN2O2/c1-6(10)4-12-5-7(11)3-8(12)9(13)14-2/h3,5H,1,4,11H2,2H3 |
| InChIKey | BKDFBEUSVZEFEN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |