C26H24F3N7O4S — CID 165417060
N-[4-(hydroxyamino)-4-oxobutyl]-5-methyl-4-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]anilino]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 165417060) has the molecular formula C26H24F3N7O4S and a molecular weight of 587.58 g/mol. Its IUPAC name is N-[4-(hydroxyamino)-4-oxobutyl]-5-methyl-4-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]anilino]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[4-(hydroxyamino)-4-oxobutyl]-5-methyl-4-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]anilino]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 165417060 |
| Molecular Formula | C26H24F3N7O4S |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | N-[4-(hydroxyamino)-4-oxobutyl]-5-methyl-4-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]anilino]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCCC(=O)NO)sc2ncnc(Nc3ccc(NC(=O)Nc4cccc(C(F)(F)F)c4)cc3)c12 |
| InChI | InChI=1S/C26H24F3N7O4S/c1-14-20-22(31-13-32-24(20)41-21(14)23(38)30-11-3-6-19(37)36-40)33-16-7-9-17(10-8-16)34-25(39)35-18-5-2-4-15(12-18)26(27,28)29/h2,4-5,7-10,12-13,40H,3,6,11H2,1H3,(H,30,38)(H,36,37)(H,31,32,33)(H2,34,35,39) |
| InChIKey | DFWIRVDXMQPWMH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 157.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|