C25H29N3O5 — CID 165420567
(E)-N-[(7S)-17-methoxy-6,13-dioxo-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(14),15,17-trien-7-yl]-3-phenylprop-2-enamide (PubChem CID 165420567) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is (E)-N-[(7S)-17-methoxy-6,13-dioxo-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(14),15,17-trien-7-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(7S)-17-methoxy-6,13-dioxo-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(14),15,17-trien-7-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 165420567 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (E)-N-[(7S)-17-methoxy-6,13-dioxo-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(14),15,17-trien-7-yl]-3-phenylprop-2-enamide |
| SMILES | COc1ccc2c(c1)OCCNC(=O)[C@@H](NC(=O)/C=C/c1ccccc1)CCCCNC2=O |
| InChI | InChI=1S/C25H29N3O5/c1-32-19-11-12-20-22(17-19)33-16-15-27-25(31)21(9-5-6-14-26-24(20)30)28-23(29)13-10-18-7-3-2-4-8-18/h2-4,7-8,10-13,17,21H,5-6,9,14-16H2,1H3,(H,26,30)(H,27,31)(H,28,29)/b13-10+/t21-/m0/s1 |
| InChIKey | MZSQFBPIMNBSKU-BGVYSJOJSA-N |
| XLogP | 2.30 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|