C18H24N2O3S — CID 165422745
1-[(3aS,6aS)-5-(cyclobutanecarbonyl)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-2-thiophen-3-ylethanone (PubChem CID 165422745) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-[(3aS,6aS)-5-(cyclobutanecarbonyl)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(3aS,6aS)-5-(cyclobutanecarbonyl)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 165422745 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-[(3aS,6aS)-5-(cyclobutanecarbonyl)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)N1C[C@H]2CN(C(=O)C3CCC3)C[C@@]2(CO)C1 |
| InChI | InChI=1S/C18H24N2O3S/c21-12-18-10-19(16(22)6-13-4-5-24-9-13)7-15(18)8-20(11-18)17(23)14-2-1-3-14/h4-5,9,14-15,21H,1-3,6-8,10-12H2/t15-,18+/m0/s1 |
| InChIKey | ZUGKUZCKGINGKU-MAUKXSAKSA-N |
| XLogP | 1.37 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |