C20H30ClN3O3 — CID 165427351
(3R,6S)-6-amino-N-[2-(2-chlorophenoxy)ethyl]-1-(oxan-4-yl)azepane-3-carboxamide (PubChem CID 165427351) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is (3R,6S)-6-amino-N-[2-(2-chlorophenoxy)ethyl]-1-(oxan-4-yl)azepane-3-carboxamide.
| Compound Name | (3R,6S)-6-amino-N-[2-(2-chlorophenoxy)ethyl]-1-(oxan-4-yl)azepane-3-carboxamide |
|---|---|
| PubChem CID | 165427351 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (3R,6S)-6-amino-N-[2-(2-chlorophenoxy)ethyl]-1-(oxan-4-yl)azepane-3-carboxamide |
| SMILES | N[C@H]1CC[C@@H](C(=O)NCCOc2ccccc2Cl)CN(C2CCOCC2)C1 |
| InChI | InChI=1S/C20H30ClN3O3/c21-18-3-1-2-4-19(18)27-12-9-23-20(25)15-5-6-16(22)14-24(13-15)17-7-10-26-11-8-17/h1-4,15-17H,5-14,22H2,(H,23,25)/t15-,16+/m1/s1 |
| InChIKey | HAMHCGCUWCYXNV-CVEARBPZSA-N |
| XLogP | 2.05 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|