C23H35N3O3 — CID 171910692
(3R,6S)-1-(oxan-4-yl)-6-[(2-phenylacetyl)amino]-N-propylazepane-3-carboxamide (PubChem CID 171910692) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is (3R,6S)-1-(oxan-4-yl)-6-[(2-phenylacetyl)amino]-N-propylazepane-3-carboxamide.
| Compound Name | (3R,6S)-1-(oxan-4-yl)-6-[(2-phenylacetyl)amino]-N-propylazepane-3-carboxamide |
|---|---|
| PubChem CID | 171910692 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | (3R,6S)-1-(oxan-4-yl)-6-[(2-phenylacetyl)amino]-N-propylazepane-3-carboxamide |
| SMILES | CCCNC(=O)[C@@H]1CC[C@H](NC(=O)Cc2ccccc2)CN(C2CCOCC2)C1 |
| InChI | InChI=1S/C23H35N3O3/c1-2-12-24-23(28)19-8-9-20(17-26(16-19)21-10-13-29-14-11-21)25-22(27)15-18-6-4-3-5-7-18/h3-7,19-21H,2,8-17H2,1H3,(H,24,28)(H,25,27)/t19-,20+/m1/s1 |
| InChIKey | HFFZWRFLXOWPCX-UXHICEINSA-N |
| XLogP | 2.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |