C22H33N3O4 — CID 171911075
(3R,6S)-N-benzyl-6-(3-hydroxypropanoylamino)-1-(oxan-4-yl)azepane-3-carboxamide (PubChem CID 171911075) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is (3R,6S)-N-benzyl-6-(3-hydroxypropanoylamino)-1-(oxan-4-yl)azepane-3-carboxamide.
| Compound Name | (3R,6S)-N-benzyl-6-(3-hydroxypropanoylamino)-1-(oxan-4-yl)azepane-3-carboxamide |
|---|---|
| PubChem CID | 171911075 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (3R,6S)-N-benzyl-6-(3-hydroxypropanoylamino)-1-(oxan-4-yl)azepane-3-carboxamide |
| SMILES | O=C(CCO)N[C@H]1CC[C@@H](C(=O)NCc2ccccc2)CN(C2CCOCC2)C1 |
| InChI | InChI=1S/C22H33N3O4/c26-11-8-21(27)24-19-7-6-18(15-25(16-19)20-9-12-29-13-10-20)22(28)23-14-17-4-2-1-3-5-17/h1-5,18-20,26H,6-16H2,(H,23,28)(H,24,27)/t18-,19+/m1/s1 |
| InChIKey | CWROZLRJABRKEP-MOPGFXCFSA-N |
| XLogP | 1.06 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |