C23H27N5O3 — CID 165427419
1'-[(3-methoxyphenyl)methyl]-2-[(6-methyl-2-pyridinyl)methyl]spiro[5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-6,3'-pyrrolidine]-3-one (PubChem CID 165427419) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 1'-[(3-methoxyphenyl)methyl]-2-[(6-methyl-2-pyridinyl)methyl]spiro[5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-6,3'-pyrrolidine]-3-one.
| Compound Name | 1'-[(3-methoxyphenyl)methyl]-2-[(6-methyl-2-pyridinyl)methyl]spiro[5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-6,3'-pyrrolidine]-3-one |
|---|---|
| PubChem CID | 165427419 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 1'-[(3-methoxyphenyl)methyl]-2-[(6-methyl-2-pyridinyl)methyl]spiro[5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-6,3'-pyrrolidine]-3-one |
| SMILES | COc1cccc(CN2CCC3(C2)Cn2c(nn(Cc4cccc(C)n4)c2=O)CO3)c1 |
| InChI | InChI=1S/C23H27N5O3/c1-17-5-3-7-19(24-17)13-28-22(29)27-16-23(31-14-21(27)25-28)9-10-26(15-23)12-18-6-4-8-20(11-18)30-2/h3-8,11H,9-10,12-16H2,1-2H3 |
| InChIKey | CFFPBRMSNXGKMK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |