C38H43F3N6O7 — CID 165427510
6,7,8-trimethoxy-13-(5-methyl-1,2-oxazole-3-carbonyl)-18-[2-(trifluoromethyl)benzoyl]-1,3,13,18,21-pentazatetracyclo[21.3.1.02,11.04,9]heptacosa-2,4,6,8,10-pentaen-20-one (PubChem CID 165427510) has the molecular formula C38H43F3N6O7 and a molecular weight of 752.79 g/mol. Its IUPAC name is 6,7,8-trimethoxy-13-(5-methyl-1,2-oxazole-3-carbonyl)-18-[2-(trifluoromethyl)benzoyl]-1,3,13,18,21-pentazatetracyclo[21.3.1.02,11.04,9]heptacosa-2,4,6,8,10-pentaen-20-one.
| Compound Name | 6,7,8-trimethoxy-13-(5-methyl-1,2-oxazole-3-carbonyl)-18-[2-(trifluoromethyl)benzoyl]-1,3,13,18,21-pentazatetracyclo[21.3.1.02,11.04,9]heptacosa-2,4,6,8,10-pentaen-20-one |
|---|---|
| PubChem CID | 165427510 |
| Molecular Formula | C38H43F3N6O7 |
| Molecular Weight | 752.79 g/mol |
| Exact Mass | 752.31 |
| IUPAC Name | 6,7,8-trimethoxy-13-(5-methyl-1,2-oxazole-3-carbonyl)-18-[2-(trifluoromethyl)benzoyl]-1,3,13,18,21-pentazatetracyclo[21.3.1.02,11.04,9]heptacosa-2,4,6,8,10-pentaen-20-one |
| SMILES | COc1cc2nc3c(cc2c(OC)c1OC)CN(C(=O)c1cc(C)on1)CCCCN(C(=O)c1ccccc1C(F)(F)F)CC(=O)NCC1CCCN3C1 |
| InChI | InChI=1S/C38H43F3N6O7/c1-23-16-30(44-54-23)37(50)46-13-7-8-14-47(36(49)26-11-5-6-12-28(26)38(39,40)41)22-32(48)42-19-24-10-9-15-45(20-24)35-25(21-46)17-27-29(43-35)18-31(51-2)34(53-4)33(27)52-3/h5-6,11-12,16-18,24H,7-10,13-15,19-22H2,1-4H3,(H,42,48) |
| InChIKey | UVZATLLPQPHXCZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.79 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |