C15H16Cl2N2 — CID 165428017
1-(cyclopentylmethyl)-2-(2,6-dichlorophenyl)imidazole (PubChem CID 165428017) has the molecular formula C15H16Cl2N2 and a molecular weight of 295.21 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-2-(2,6-dichlorophenyl)imidazole.
| Compound Name | 1-(cyclopentylmethyl)-2-(2,6-dichlorophenyl)imidazole |
|---|---|
| PubChem CID | 165428017 |
| Molecular Formula | C15H16Cl2N2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 1-(cyclopentylmethyl)-2-(2,6-dichlorophenyl)imidazole |
| SMILES | Clc1cccc(Cl)c1-c1nccn1CC1CCCC1 |
| InChI | InChI=1S/C15H16Cl2N2/c16-12-6-3-7-13(17)14(12)15-18-8-9-19(15)10-11-4-1-2-5-11/h3,6-9,11H,1-2,4-5,10H2 |
| InChIKey | AUUBXGCPNUJUMR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |