C16H16Cl2N2O2 — CID 166619085
4-[2-(2,6-dichlorophenyl)imidazol-1-yl]cyclohexane-1-carboxylic acid (PubChem CID 166619085) has the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is 4-[2-(2,6-dichlorophenyl)imidazol-1-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-(2,6-dichlorophenyl)imidazol-1-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 166619085 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 4-[2-(2,6-dichlorophenyl)imidazol-1-yl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(n2ccnc2-c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C16H16Cl2N2O2/c17-12-2-1-3-13(18)14(12)15-19-8-9-20(15)11-6-4-10(5-7-11)16(21)22/h1-3,8-11H,4-7H2,(H,21,22) |
| InChIKey | KICPOSWNVLFJKJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |