C24H24N6 — CID 165428195
3-[2-[4-methyl-6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]pyrrol-1-yl]benzonitrile (PubChem CID 165428195) has the molecular formula C24H24N6 and a molecular weight of 396.50 g/mol. Its IUPAC name is 3-[2-[4-methyl-6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]pyrrol-1-yl]benzonitrile.
| Compound Name | 3-[2-[4-methyl-6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]pyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 165428195 |
| Molecular Formula | C24H24N6 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 3-[2-[4-methyl-6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]pyrrol-1-yl]benzonitrile |
| SMILES | Cc1cc(N2CCN(C)CC2)cc2[nH]c(-c3cccn3-c3cccc(C#N)c3)nc12 |
| InChI | InChI=1S/C24H24N6/c1-17-13-20(29-11-9-28(2)10-12-29)15-21-23(17)27-24(26-21)22-7-4-8-30(22)19-6-3-5-18(14-19)16-25/h3-8,13-15H,9-12H2,1-2H3,(H,26,27) |
| InChIKey | KAGKWRZUBDDYSQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |