C21H27N5 — CID 165428200
2-[4-[4-methyl-6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]phenyl]ethanamine (PubChem CID 165428200) has the molecular formula C21H27N5 and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-[4-[4-methyl-6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]phenyl]ethanamine.
| Compound Name | 2-[4-[4-methyl-6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]phenyl]ethanamine |
|---|---|
| PubChem CID | 165428200 |
| Molecular Formula | C21H27N5 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 2-[4-[4-methyl-6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]phenyl]ethanamine |
| SMILES | Cc1cc(N2CCN(C)CC2)cc2[nH]c(-c3ccc(CCN)cc3)nc12 |
| InChI | InChI=1S/C21H27N5/c1-15-13-18(26-11-9-25(2)10-12-26)14-19-20(15)24-21(23-19)17-5-3-16(4-6-17)7-8-22/h3-6,13-14H,7-12,22H2,1-2H3,(H,23,24) |
| InChIKey | XSFXJZJNIPGLAI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |