C15H20INO3 — CID 165429412
methyl 2-[3-[(2-iodophenoxy)methyl]piperidin-1-yl]acetate (PubChem CID 165429412) has the molecular formula C15H20INO3 and a molecular weight of 389.23 g/mol. Its IUPAC name is methyl 2-[3-[(2-iodophenoxy)methyl]piperidin-1-yl]acetate.
| Compound Name | methyl 2-[3-[(2-iodophenoxy)methyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 165429412 |
| Molecular Formula | C15H20INO3 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | methyl 2-[3-[(2-iodophenoxy)methyl]piperidin-1-yl]acetate |
| SMILES | COC(=O)CN1CCCC(COc2ccccc2I)C1 |
| InChI | InChI=1S/C15H20INO3/c1-19-15(18)10-17-8-4-5-12(9-17)11-20-14-7-3-2-6-13(14)16/h2-3,6-7,12H,4-5,8-11H2,1H3 |
| InChIKey | KAELFYGUOYURCZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|