C14H10F5N3O2 — CID 165432706
6-(difluoromethyl)-2-methyl-N-[2-(trifluoromethoxy)phenyl]pyrimidine-4-carboxamide (PubChem CID 165432706) has the molecular formula C14H10F5N3O2 and a molecular weight of 347.24 g/mol. Its IUPAC name is 6-(difluoromethyl)-2-methyl-N-[2-(trifluoromethoxy)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(difluoromethyl)-2-methyl-N-[2-(trifluoromethoxy)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 165432706 |
| Molecular Formula | C14H10F5N3O2 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 6-(difluoromethyl)-2-methyl-N-[2-(trifluoromethoxy)phenyl]pyrimidine-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccccc2OC(F)(F)F)cc(C(F)F)n1 |
| InChI | InChI=1S/C14H10F5N3O2/c1-7-20-9(12(15)16)6-10(21-7)13(23)22-8-4-2-3-5-11(8)24-14(17,18)19/h2-6,12H,1H3,(H,22,23) |
| InChIKey | KHXOFBDJFHTFIL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |