C19H28N6 — CID 165432983
4-[4-(cyclohexylmethyl)piperazin-1-yl]-2-methyl-6-pyrazol-1-ylpyrimidine (PubChem CID 165432983) has the molecular formula C19H28N6 and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-[4-(cyclohexylmethyl)piperazin-1-yl]-2-methyl-6-pyrazol-1-ylpyrimidine.
| Compound Name | 4-[4-(cyclohexylmethyl)piperazin-1-yl]-2-methyl-6-pyrazol-1-ylpyrimidine |
|---|---|
| PubChem CID | 165432983 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 4-[4-(cyclohexylmethyl)piperazin-1-yl]-2-methyl-6-pyrazol-1-ylpyrimidine |
| SMILES | Cc1nc(N2CCN(CC3CCCCC3)CC2)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C19H28N6/c1-16-21-18(14-19(22-16)25-9-5-8-20-25)24-12-10-23(11-13-24)15-17-6-3-2-4-7-17/h5,8-9,14,17H,2-4,6-7,10-13,15H2,1H3 |
| InChIKey | OUTMMCJKAIRGMM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |