C15H23F2N3O2 — CID 165434079
2-[3-(4,4-difluoropiperidine-1-carbonyl)pyrrolidin-1-yl]-N-prop-2-enylacetamide (PubChem CID 165434079) has the molecular formula C15H23F2N3O2 and a molecular weight of 315.36 g/mol. Its IUPAC name is 2-[3-(4,4-difluoropiperidine-1-carbonyl)pyrrolidin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[3-(4,4-difluoropiperidine-1-carbonyl)pyrrolidin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 165434079 |
| Molecular Formula | C15H23F2N3O2 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-[3-(4,4-difluoropiperidine-1-carbonyl)pyrrolidin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCC(C(=O)N2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C15H23F2N3O2/c1-2-6-18-13(21)11-19-7-3-12(10-19)14(22)20-8-4-15(16,17)5-9-20/h2,12H,1,3-11H2,(H,18,21) |
| InChIKey | ZKUALFIRFLIEKX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|