C13H22N2O3 — CID 81339260
ethyl (3S)-1-[2-oxo-2-(prop-2-enylamino)ethyl]piperidine-3-carboxylate (PubChem CID 81339260) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is ethyl (3S)-1-[2-oxo-2-(prop-2-enylamino)ethyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-oxo-2-(prop-2-enylamino)ethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 81339260 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | ethyl (3S)-1-[2-oxo-2-(prop-2-enylamino)ethyl]piperidine-3-carboxylate |
| SMILES | C=CCNC(=O)CN1CCC[C@H](C(=O)OCC)C1 |
| InChI | InChI=1S/C13H22N2O3/c1-3-7-14-12(16)10-15-8-5-6-11(9-15)13(17)18-4-2/h3,11H,1,4-10H2,2H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | LBSYXFLHFGNDTN-NSHDSACASA-N |
| XLogP | 0.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|