C13H21N3O3 — CID 46650338
ethyl 1-[2-(2-cyanoethylamino)-2-oxoethyl]piperidine-3-carboxylate (PubChem CID 46650338) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is ethyl 1-[2-(2-cyanoethylamino)-2-oxoethyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(2-cyanoethylamino)-2-oxoethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46650338 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | ethyl 1-[2-(2-cyanoethylamino)-2-oxoethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(CC(=O)NCCC#N)C1 |
| InChI | InChI=1S/C13H21N3O3/c1-2-19-13(18)11-5-3-8-16(9-11)10-12(17)15-7-4-6-14/h11H,2-5,7-10H2,1H3,(H,15,17) |
| InChIKey | IIHTXMYRBZYZBP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|