C18H22FN3O2 — CID 165435291
1-[(2,5-dimethoxyphenyl)methyl]-4-(3-fluoro-2-pyridinyl)piperazine (PubChem CID 165435291) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-[(2,5-dimethoxyphenyl)methyl]-4-(3-fluoro-2-pyridinyl)piperazine.
| Compound Name | 1-[(2,5-dimethoxyphenyl)methyl]-4-(3-fluoro-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 165435291 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[(2,5-dimethoxyphenyl)methyl]-4-(3-fluoro-2-pyridinyl)piperazine |
| SMILES | COc1ccc(OC)c(CN2CCN(c3ncccc3F)CC2)c1 |
| InChI | InChI=1S/C18H22FN3O2/c1-23-15-5-6-17(24-2)14(12-15)13-21-8-10-22(11-9-21)18-16(19)4-3-7-20-18/h3-7,12H,8-11,13H2,1-2H3 |
| InChIKey | KPLOBYRVLCSEQH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |